C9H25Cl2N3 — CID 160877292
2-chloro-N,N-dimethylethanamine;N,N',N'-trimethylethane-1,2-diamine;hydrochloride (PubChem CID 160877292) has the molecular formula C9H25Cl2N3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethanamine;N,N',N'-trimethylethane-1,2-diamine;hydrochloride.
| Compound Name | 2-chloro-N,N-dimethylethanamine;N,N',N'-trimethylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 160877292 |
| Molecular Formula | C9H25Cl2N3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-chloro-N,N-dimethylethanamine;N,N',N'-trimethylethane-1,2-diamine;hydrochloride |
| SMILES | CN(C)CCCl.CNCCN(C)C.Cl |
| InChI | InChI=1S/C5H14N2.C4H10ClN.ClH/c1-6-4-5-7(2)3;1-6(2)4-3-5;/h6H,4-5H2,1-3H3;3-4H2,1-2H3;1H |
| InChIKey | AOLGFOSCXWELBZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|