C8H19ClN2 — CID 83186512
N-(4-chlorobutan-2-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 83186512) has the molecular formula C8H19ClN2 and a molecular weight of 178.71 g/mol. Its IUPAC name is N-(4-chlorobutan-2-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(4-chlorobutan-2-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 83186512 |
| Molecular Formula | C8H19ClN2 |
| Molecular Weight | 178.71 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N-(4-chlorobutan-2-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CC(CCCl)NCCN(C)C |
| InChI | InChI=1S/C8H19ClN2/c1-8(4-5-9)10-6-7-11(2)3/h8,10H,4-7H2,1-3H3 |
| InChIKey | CIXKCJRQPGGFFU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.71 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|