About N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen
N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen (PubChem CID 145190713) has the molecular formula C7H20N2
and a molecular weight of 132.25 g/mol. Its IUPAC name is N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen.
Analyze N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen?
The IUPAC name of N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen (CID 145190713) is N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen.
What is the SMILES notation for N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen?
The canonical SMILES for N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen is CC(C)NCCN(C)C.[H][H].
What is the InChIKey of N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen?
The InChIKey is JUFFDEHFKSBMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2.H2/c1-7(2)8-5-6-9(3)4;/h7-8H,5-6H2,1-4H3;1H.
What are the key properties of N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen?
N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen has a molecular weight of 132.25 g/mol, XLogP of 0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethyl-N-propan-2-ylethane-1,2-diamine;molecular hydrogen is sourced from PubChem (CID 145190713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).