C11H27N3 — CID 63694492
N'-[2-(dimethylamino)ethyl]-N'-methyl-N-propan-2-ylpropane-1,3-diamine (PubChem CID 63694492) has the molecular formula C11H27N3 and a molecular weight of 201.36 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N'-methyl-N-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N'-methyl-N-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63694492 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N'-methyl-N-propan-2-ylpropane-1,3-diamine |
| SMILES | CC(C)NCCCN(C)CCN(C)C |
| InChI | InChI=1S/C11H27N3/c1-11(2)12-7-6-8-14(5)10-9-13(3)4/h11-12H,6-10H2,1-5H3 |
| InChIKey | ZHLPHIDDEUHAOM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|