C14H35N3 — CID 163269208
ethane;N-ethyl-N'-methyl-N'-[3-(propan-2-ylamino)propyl]propane-1,3-diamine (PubChem CID 163269208) has the molecular formula C14H35N3 and a molecular weight of 245.45 g/mol. Its IUPAC name is ethane;N-ethyl-N'-methyl-N'-[3-(propan-2-ylamino)propyl]propane-1,3-diamine.
| Compound Name | ethane;N-ethyl-N'-methyl-N'-[3-(propan-2-ylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 163269208 |
| Molecular Formula | C14H35N3 |
| Molecular Weight | 245.45 g/mol |
| Exact Mass | 245.28 |
| IUPAC Name | ethane;N-ethyl-N'-methyl-N'-[3-(propan-2-ylamino)propyl]propane-1,3-diamine |
| SMILES | CC.CCNCCCN(C)CCCNC(C)C |
| InChI | InChI=1S/C12H29N3.C2H6/c1-5-13-8-6-10-15(4)11-7-9-14-12(2)3;1-2/h12-14H,5-11H2,1-4H3;1-2H3 |
| InChIKey | DBOJZVLNSKVTDU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|