C7H17ClN2 — CID 65025453
N-(1-chloropropan-2-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 65025453) has the molecular formula C7H17ClN2 and a molecular weight of 164.68 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(1-chloropropan-2-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 65025453 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CC(CCl)NCCN(C)C |
| InChI | InChI=1S/C7H17ClN2/c1-7(6-8)9-4-5-10(2)3/h7,9H,4-6H2,1-3H3 |
| InChIKey | GRAUYCRXAVBOOA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|