C23H50Cl2N2 — CID 141033111
N'-(5-chloropentyl)-N,N'-dimethylhexadecane-1,16-diamine;hydrochloride (PubChem CID 141033111) has the molecular formula C23H50Cl2N2 and a molecular weight of 425.57 g/mol. Its IUPAC name is N'-(5-chloropentyl)-N,N'-dimethylhexadecane-1,16-diamine;hydrochloride.
| Compound Name | N'-(5-chloropentyl)-N,N'-dimethylhexadecane-1,16-diamine;hydrochloride |
|---|---|
| PubChem CID | 141033111 |
| Molecular Formula | C23H50Cl2N2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | N'-(5-chloropentyl)-N,N'-dimethylhexadecane-1,16-diamine;hydrochloride |
| SMILES | CNCCCCCCCCCCCCCCCCN(C)CCCCCCl.Cl |
| InChI | InChI=1S/C23H49ClN2.ClH/c1-25-21-17-13-11-9-7-5-3-4-6-8-10-12-14-18-22-26(2)23-19-15-16-20-24;/h25H,3-23H2,1-2H3;1H |
| InChIKey | DOLLZBHQQRVFRK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|