C20H44N2 — CID 139950987
N,N'-dimethyl-N'-tetradecylbutane-1,4-diamine (PubChem CID 139950987) has the molecular formula C20H44N2 and a molecular weight of 312.59 g/mol. Its IUPAC name is N,N'-dimethyl-N'-tetradecylbutane-1,4-diamine.
| Compound Name | N,N'-dimethyl-N'-tetradecylbutane-1,4-diamine |
|---|---|
| PubChem CID | 139950987 |
| Molecular Formula | C20H44N2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.35 |
| IUPAC Name | N,N'-dimethyl-N'-tetradecylbutane-1,4-diamine |
| SMILES | CCCCCCCCCCCCCCN(C)CCCCNC |
| InChI | InChI=1S/C20H44N2/c1-4-5-6-7-8-9-10-11-12-13-14-16-19-22(3)20-17-15-18-21-2/h21H,4-20H2,1-3H3 |
| InChIKey | HOSGLYBONOCXLS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|