C21H46N2 — CID 23574295
N'-heptadecyl-N,N'-dimethylethane-1,2-diamine (PubChem CID 23574295) has the molecular formula C21H46N2 and a molecular weight of 326.61 g/mol. Its IUPAC name is N'-heptadecyl-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-heptadecyl-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 23574295 |
| Molecular Formula | C21H46N2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.37 |
| IUPAC Name | N'-heptadecyl-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCCCCCCCCCCCCCCCCN(C)CCNC |
| InChI | InChI=1S/C21H46N2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(3)21-19-22-2/h22H,4-21H2,1-3H3 |
| InChIKey | ZVFJWCAHYZBCAD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|