C9H28N4 — CID 23104245
azane;N,N',N'-trimethylhexane-1,6-diamine (PubChem CID 23104245) has the molecular formula C9H28N4 and a molecular weight of 192.35 g/mol. Its IUPAC name is azane;N,N',N'-trimethylhexane-1,6-diamine.
| Compound Name | azane;N,N',N'-trimethylhexane-1,6-diamine |
|---|---|
| PubChem CID | 23104245 |
| Molecular Formula | C9H28N4 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.23 |
| IUPAC Name | azane;N,N',N'-trimethylhexane-1,6-diamine |
| SMILES | CNCCCCCCN(C)C.N.N |
| InChI | InChI=1S/C9H22N2.2H3N/c1-10-8-6-4-5-7-9-11(2)3;;/h10H,4-9H2,1-3H3;2*1H3 |
| InChIKey | RZOXNNJXIBNQBI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|