About CID 137019099
CID 137019099 (PubChem CID 137019099) has the molecular formula C8H19BN2-
and a molecular weight of 154.07 g/mol.
Molecular Properties
| Compound Name | CID 137019099 |
| PubChem CID | 137019099 |
| Molecular Formula | C8H19BN2- |
| Molecular Weight | 154.07 g/mol |
| Exact Mass | 154.16 |
| IUPAC Name | — |
| SMILES | [B-]N(C)CCCCCCNC |
| InChI | InChI=1S/C8H19BN2/c1-10-7-5-3-4-6-8-11(2)9/h10H,3-8H2,1-2H3/q-1 |
| InChIKey | JJUXZOJBKDZVON-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.07 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 137019099 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137019099?
The IUPAC name of CID 137019099 (CID 137019099) is not available.
What is the SMILES notation for CID 137019099?
The canonical SMILES for CID 137019099 is [B-]N(C)CCCCCCNC.
What is the InChIKey of CID 137019099?
The InChIKey is JJUXZOJBKDZVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19BN2/c1-10-7-5-3-4-6-8-11(2)9/h10H,3-8H2,1-2H3/q-1.
What are the key properties of CID 137019099?
CID 137019099 has a molecular weight of 154.07 g/mol, XLogP of 0.78, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137019099 is sourced from PubChem (CID 137019099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).