C6H16LiN2 — CID 88826921
CID 88826921 (PubChem CID 88826921) has the molecular formula C6H16LiN2 and a molecular weight of 123.15 g/mol.
| Compound Name | CID 88826921 |
|---|---|
| PubChem CID | 88826921 |
| Molecular Formula | C6H16LiN2 |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.15 |
| IUPAC Name | — |
| SMILES | CN(C)CCN(C)C.[Li] |
| InChI | InChI=1S/C6H16N2.Li/c1-7(2)5-6-8(3)4;/h5-6H2,1-4H3; |
| InChIKey | YEYKVVYJAMSLSO-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |