C6H16Cl2N2Sn — CID 174892768
N,N,N',N'-tetramethylethane-1,2-diamine;tin(2+);dichloride (PubChem CID 174892768) has the molecular formula C6H16Cl2N2Sn and a molecular weight of 305.83 g/mol. Its IUPAC name is N,N,N',N'-tetramethylethane-1,2-diamine;tin(2+);dichloride.
| Compound Name | N,N,N',N'-tetramethylethane-1,2-diamine;tin(2+);dichloride |
|---|---|
| PubChem CID | 174892768 |
| Molecular Formula | C6H16Cl2N2Sn |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | N,N,N',N'-tetramethylethane-1,2-diamine;tin(2+);dichloride |
| SMILES | CN(C)CCN(C)C.[Cl-].[Cl-].[Sn+2] |
| InChI | InChI=1S/C6H16N2.2ClH.Sn/c1-7(2)5-6-8(3)4;;;/h5-6H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | IFUWVVTWGVOJCX-UHFFFAOYSA-L |
| XLogP | -6.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | -6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |