About CID 173338058
CID 173338058 (PubChem CID 173338058) has the molecular formula C12H32LiN4
and a molecular weight of 239.36 g/mol.
Molecular Properties
| Compound Name | CID 173338058 |
| PubChem CID | 173338058 |
| Molecular Formula | C12H32LiN4 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.28 |
| IUPAC Name | — |
| SMILES | CN(C)CCN(C)C.CN(C)CCN(C)C.[Li] |
| InChI | InChI=1S/2C6H16N2.Li/c2*1-7(2)5-6-8(3)4;/h2*5-6H2,1-4H3; |
| InChIKey | NIGLMLQLVPHJGC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 173338058 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173338058?
The IUPAC name of CID 173338058 (CID 173338058) is not available.
What is the SMILES notation for CID 173338058?
The canonical SMILES for CID 173338058 is CN(C)CCN(C)C.CN(C)CCN(C)C.[Li].
What is the InChIKey of CID 173338058?
The InChIKey is NIGLMLQLVPHJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H16N2.Li/c2*1-7(2)5-6-8(3)4;/h2*5-6H2,1-4H3;.
What are the key properties of CID 173338058?
CID 173338058 has a molecular weight of 239.36 g/mol, XLogP of -0.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173338058 is sourced from PubChem (CID 173338058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).