C6H16N2Na2 — CID 175787026
CID 175787026 (PubChem CID 175787026) has the molecular formula C6H16N2Na2 and a molecular weight of 162.19 g/mol.
| Compound Name | CID 175787026 |
|---|---|
| PubChem CID | 175787026 |
| Molecular Formula | C6H16N2Na2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | — |
| SMILES | CN(C)CCN(C)C.[Na].[Na] |
| InChI | InChI=1S/C6H16N2.2Na/c1-7(2)5-6-8(3)4;;/h5-6H2,1-4H3;; |
| InChIKey | RANLNDHSRRSOCB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |