C10H22N2 — CID 160608362
buta-1,3-diene;N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 160608362) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is buta-1,3-diene;N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | buta-1,3-diene;N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 160608362 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | buta-1,3-diene;N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | C=CC=C.CN(C)CCN(C)C |
| InChI | InChI=1S/C6H16N2.C4H6/c1-7(2)5-6-8(3)4;1-3-4-2/h5-6H2,1-4H3;3-4H,1-2H2 |
| InChIKey | RFEHOWMRMIWYKK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|