About N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane
N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane (PubChem CID 143296680) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane.
Analyze N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane?
The IUPAC name of N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane (CID 143296680) is N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane.
What is the SMILES notation for N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane?
The canonical SMILES for N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane is CC.CCN(CC)CCN(C)C.
What is the InChIKey of N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane?
The InChIKey is NSZBIMIUDGHSON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2.C2H6/c1-5-10(6-2)8-7-9(3)4;1-2/h5-8H2,1-4H3;1-2H3.
What are the key properties of N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane?
N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane has a molecular weight of 174.33 g/mol, XLogP of 1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethyl-N,N-dimethylethane-1,2-diamine;ethane is sourced from PubChem (CID 143296680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).