C10H26N2O — CID 158783617
2-(diethylamino)ethanol;N,N-dimethylethanamine (PubChem CID 158783617) has the molecular formula C10H26N2O and a molecular weight of 190.33 g/mol. Its IUPAC name is 2-(diethylamino)ethanol;N,N-dimethylethanamine.
| Compound Name | 2-(diethylamino)ethanol;N,N-dimethylethanamine |
|---|---|
| PubChem CID | 158783617 |
| Molecular Formula | C10H26N2O |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.20 |
| IUPAC Name | 2-(diethylamino)ethanol;N,N-dimethylethanamine |
| SMILES | CCN(C)C.CCN(CC)CCO |
| InChI | InChI=1S/C6H15NO.C4H11N/c1-3-7(4-2)5-6-8;1-4-5(2)3/h8H,3-6H2,1-2H3;4H2,1-3H3 |
| InChIKey | IRJXBJMWZOBZDF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |