C12H28Br2N2 — CID 170854608
1,3-dibromopropane;N',N'-diethyl-N,N-dimethylpropane-1,3-diamine (PubChem CID 170854608) has the molecular formula C12H28Br2N2 and a molecular weight of 360.18 g/mol. Its IUPAC name is 1,3-dibromopropane;N',N'-diethyl-N,N-dimethylpropane-1,3-diamine.
| Compound Name | 1,3-dibromopropane;N',N'-diethyl-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 170854608 |
| Molecular Formula | C12H28Br2N2 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1,3-dibromopropane;N',N'-diethyl-N,N-dimethylpropane-1,3-diamine |
| SMILES | BrCCCBr.CCN(CC)CCCN(C)C |
| InChI | InChI=1S/C9H22N2.C3H6Br2/c1-5-11(6-2)9-7-8-10(3)4;4-2-1-3-5/h5-9H2,1-4H3;1-3H2 |
| InChIKey | YHHOJFNCNBLOLP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|