C11H26N2 — CID 89150859
N,N-dimethyl-N',N'-dipropylpropane-1,3-diamine (PubChem CID 89150859) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is N,N-dimethyl-N',N'-dipropylpropane-1,3-diamine.
| Compound Name | N,N-dimethyl-N',N'-dipropylpropane-1,3-diamine |
|---|---|
| PubChem CID | 89150859 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | N,N-dimethyl-N',N'-dipropylpropane-1,3-diamine |
| SMILES | CCCN(CCC)CCCN(C)C |
| InChI | InChI=1S/C11H26N2/c1-5-8-13(9-6-2)11-7-10-12(3)4/h5-11H2,1-4H3 |
| InChIKey | WWVVDFPURURJEQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |