C9H25N — CID 142050981
N,N-dimethylbutan-1-amine;ethane;methane (PubChem CID 142050981) has the molecular formula C9H25N and a molecular weight of 147.31 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;ethane;methane.
| Compound Name | N,N-dimethylbutan-1-amine;ethane;methane |
|---|---|
| PubChem CID | 142050981 |
| Molecular Formula | C9H25N |
| Molecular Weight | 147.31 g/mol |
| Exact Mass | 147.20 |
| IUPAC Name | N,N-dimethylbutan-1-amine;ethane;methane |
| SMILES | C.CC.CCCCN(C)C |
| InChI | InChI=1S/C6H15N.C2H6.CH4/c1-4-5-6-7(2)3;1-2;/h4-6H2,1-3H3;1-2H3;1H4 |
| InChIKey | VMYGMLYTHOOANQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |