C6H17Cl2N — CID 174248401
N,N-dimethylbutan-1-amine;dihydrochloride (PubChem CID 174248401) has the molecular formula C6H17Cl2N and a molecular weight of 174.12 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;dihydrochloride.
| Compound Name | N,N-dimethylbutan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 174248401 |
| Molecular Formula | C6H17Cl2N |
| Molecular Weight | 174.12 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | N,N-dimethylbutan-1-amine;dihydrochloride |
| SMILES | CCCCN(C)C.Cl.Cl |
| InChI | InChI=1S/C6H15N.2ClH/c1-4-5-6-7(2)3;;/h4-6H2,1-3H3;2*1H |
| InChIKey | KOGJADACTLLVGX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |