About Tripropylamineborane
Tripropylamineborane (PubChem CID 21315686) has the molecular formula C9H21BN
and a molecular weight of 154.09 g/mol.
Molecular Properties
| Compound Name | Tripropylamineborane |
| PubChem CID | 21315686 |
| Molecular Formula | C9H21BN |
| Molecular Weight | 154.09 g/mol |
| Exact Mass | 154.18 |
| IUPAC Name | — |
| SMILES | CCCN(CCC)CCC.[B] |
| InChI | InChI=1S/C9H21N.B/c1-4-7-10(8-5-2)9-6-3;/h4-9H2,1-3H3; |
| InChIKey | AXBJAAQBVCKQEF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.09 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Tripropylamineborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tripropylamineborane?
The IUPAC name of Tripropylamineborane (CID 21315686) is not available.
What is the SMILES notation for Tripropylamineborane?
The canonical SMILES for Tripropylamineborane is CCCN(CCC)CCC.[B].
What is the InChIKey of Tripropylamineborane?
The InChIKey is AXBJAAQBVCKQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.B/c1-4-7-10(8-5-2)9-6-3;/h4-9H2,1-3H3;.
What are the key properties of Tripropylamineborane?
Tripropylamineborane has a molecular weight of 154.09 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Tripropylamineborane is sourced from PubChem (CID 21315686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).