C9H21ClNNa — CID 175189857
sodium;N,N-dipropylpropan-1-amine;chloride (PubChem CID 175189857) has the molecular formula C9H21ClNNa and a molecular weight of 201.72 g/mol. Its IUPAC name is sodium;N,N-dipropylpropan-1-amine;chloride.
| Compound Name | sodium;N,N-dipropylpropan-1-amine;chloride |
|---|---|
| PubChem CID | 175189857 |
| Molecular Formula | C9H21ClNNa |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | sodium;N,N-dipropylpropan-1-amine;chloride |
| SMILES | CCCN(CCC)CCC.[Cl-].[Na+] |
| InChI | InChI=1S/C9H21N.ClH.Na/c1-4-7-10(8-5-2)9-6-3;;/h4-9H2,1-3H3;1H;/q;;+1/p-1 |
| InChIKey | HABOOCBRENSDKJ-UHFFFAOYSA-M |
| XLogP | -3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |