C15H36N2 — CID 22257187
N,N-diethylethanamine;N,N-dipropylpropan-1-amine (PubChem CID 22257187) has the molecular formula C15H36N2 and a molecular weight of 244.47 g/mol. Its IUPAC name is N,N-diethylethanamine;N,N-dipropylpropan-1-amine.
| Compound Name | N,N-diethylethanamine;N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 22257187 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | N,N-diethylethanamine;N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCC.CCN(CC)CC |
| InChI | InChI=1S/C9H21N.C6H15N/c1-4-7-10(8-5-2)9-6-3;1-4-7(5-2)6-3/h4-9H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | ITOXMFKNJNRZDT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |