C8H21N — CID 144711865
N,N-diethylpropan-1-amine;methane (PubChem CID 144711865) has the molecular formula C8H21N and a molecular weight of 131.26 g/mol. Its IUPAC name is N,N-diethylpropan-1-amine;methane.
| Compound Name | N,N-diethylpropan-1-amine;methane |
|---|---|
| PubChem CID | 144711865 |
| Molecular Formula | C8H21N |
| Molecular Weight | 131.26 g/mol |
| Exact Mass | 131.17 |
| IUPAC Name | N,N-diethylpropan-1-amine;methane |
| SMILES | C.CCCN(CC)CC |
| InChI | InChI=1S/C7H17N.CH4/c1-4-7-8(5-2)6-3;/h4-7H2,1-3H3;1H4 |
| InChIKey | XXYIUFXPQCKKCC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |