C16H38Br2N2 — CID 90390168
1,4-dibromobutane;bis(N,N-diethylethanamine) (PubChem CID 90390168) has the molecular formula C16H38Br2N2 and a molecular weight of 418.30 g/mol. Its IUPAC name is 1,4-dibromobutane;bis(N,N-diethylethanamine).
| Compound Name | 1,4-dibromobutane;bis(N,N-diethylethanamine) |
|---|---|
| PubChem CID | 90390168 |
| Molecular Formula | C16H38Br2N2 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1,4-dibromobutane;bis(N,N-diethylethanamine) |
| SMILES | BrCCCCBr.CCN(CC)CC.CCN(CC)CC |
| InChI | InChI=1S/2C6H15N.C4H8Br2/c2*1-4-7(5-2)6-3;5-3-1-2-4-6/h2*4-6H2,1-3H3;1-4H2 |
| InChIKey | RHDXEMXSGJHZBR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|