About 1-bromobutane;N,N-diethylethanamine
1-bromobutane;N,N-diethylethanamine (PubChem CID 87357591) has the molecular formula C10H24BrN
and a molecular weight of 238.21 g/mol. Its IUPAC name is 1-bromobutane;N,N-diethylethanamine.
Molecular Properties
| Compound Name | 1-bromobutane;N,N-diethylethanamine |
| PubChem CID | 87357591 |
| Molecular Formula | C10H24BrN |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 1-bromobutane;N,N-diethylethanamine |
| SMILES | CCCCBr.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C4H9Br/c1-4-7(5-2)6-3;1-2-3-4-5/h4-6H2,1-3H3;2-4H2,1H3 |
| InChIKey | ZBWPUIHSSYZXON-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromobutane;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromobutane;N,N-diethylethanamine?
The IUPAC name of 1-bromobutane;N,N-diethylethanamine (CID 87357591) is 1-bromobutane;N,N-diethylethanamine.
What is the SMILES notation for 1-bromobutane;N,N-diethylethanamine?
The canonical SMILES for 1-bromobutane;N,N-diethylethanamine is CCCCBr.CCN(CC)CC.
What is the InChIKey of 1-bromobutane;N,N-diethylethanamine?
The InChIKey is ZBWPUIHSSYZXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H9Br/c1-4-7(5-2)6-3;1-2-3-4-5/h4-6H2,1-3H3;2-4H2,1H3.
What are the key properties of 1-bromobutane;N,N-diethylethanamine?
1-bromobutane;N,N-diethylethanamine has a molecular weight of 238.21 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromobutane;N,N-diethylethanamine is sourced from PubChem (CID 87357591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).