C11H25Br2N — CID 174758884
1,5-dibromopentane;N,N-diethylethanamine (PubChem CID 174758884) has the molecular formula C11H25Br2N and a molecular weight of 331.14 g/mol. Its IUPAC name is 1,5-dibromopentane;N,N-diethylethanamine.
| Compound Name | 1,5-dibromopentane;N,N-diethylethanamine |
|---|---|
| PubChem CID | 174758884 |
| Molecular Formula | C11H25Br2N |
| Molecular Weight | 331.14 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1,5-dibromopentane;N,N-diethylethanamine |
| SMILES | BrCCCCCBr.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C5H10Br2/c1-4-7(5-2)6-3;6-4-2-1-3-5-7/h4-6H2,1-3H3;1-5H2 |
| InChIKey | NRQOVOITYGQXNA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|