C10H28N2 — CID 143559684
ethane;propane;N,N',N'-trimethylethane-1,2-diamine (PubChem CID 143559684) has the molecular formula C10H28N2 and a molecular weight of 176.35 g/mol. Its IUPAC name is ethane;propane;N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | ethane;propane;N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 143559684 |
| Molecular Formula | C10H28N2 |
| Molecular Weight | 176.35 g/mol |
| Exact Mass | 176.23 |
| IUPAC Name | ethane;propane;N,N',N'-trimethylethane-1,2-diamine |
| SMILES | CC.CCC.CNCCN(C)C |
| InChI | InChI=1S/C5H14N2.C3H8.C2H6/c1-6-4-5-7(2)3;1-3-2;1-2/h6H,4-5H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | SXMWSCWDYVGJPE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |