C9H24Cl4N2 — CID 19917203
2-chloro-N,N-dimethylethanamine;3-chloro-N,N-dimethylpropan-1-amine;dihydrochloride (PubChem CID 19917203) has the molecular formula C9H24Cl4N2 and a molecular weight of 302.12 g/mol. Its IUPAC name is 2-chloro-N,N-dimethylethanamine;3-chloro-N,N-dimethylpropan-1-amine;dihydrochloride.
| Compound Name | 2-chloro-N,N-dimethylethanamine;3-chloro-N,N-dimethylpropan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 19917203 |
| Molecular Formula | C9H24Cl4N2 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-chloro-N,N-dimethylethanamine;3-chloro-N,N-dimethylpropan-1-amine;dihydrochloride |
| SMILES | CN(C)CCCCl.CN(C)CCCl.Cl.Cl |
| InChI | InChI=1S/C5H12ClN.C4H10ClN.2ClH/c1-7(2)5-3-4-6;1-6(2)4-3-5;;/h3-5H2,1-2H3;3-4H2,1-2H3;2*1H |
| InChIKey | ZMLRHMSHKPJDJN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|