C5H13ClIN — CID 134304472
3-iodo-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 134304472) has the molecular formula C5H13ClIN and a molecular weight of 249.52 g/mol. Its IUPAC name is 3-iodo-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | 3-iodo-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 134304472 |
| Molecular Formula | C5H13ClIN |
| Molecular Weight | 249.52 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 3-iodo-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCI.Cl |
| InChI | InChI=1S/C5H12IN.ClH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H |
| InChIKey | YHEGSBUEYSXGCM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|