About 17-iodo-N,N-dimethylheptadecan-1-amine
17-iodo-N,N-dimethylheptadecan-1-amine (PubChem CID 171063182) has the molecular formula C19H40IN
and a molecular weight of 409.44 g/mol. Its IUPAC name is 17-iodo-N,N-dimethylheptadecan-1-amine.
Molecular Properties
| Compound Name | 17-iodo-N,N-dimethylheptadecan-1-amine |
| PubChem CID | 171063182 |
| Molecular Formula | C19H40IN |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 17-iodo-N,N-dimethylheptadecan-1-amine |
| SMILES | CN(C)CCCCCCCCCCCCCCCCCI |
| InChI | InChI=1S/C19H40IN/c1-21(2)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20/h3-19H2,1-2H3 |
| InChIKey | OBUJZCQBXPDMSX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 17-iodo-N,N-dimethylheptadecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-iodo-N,N-dimethylheptadecan-1-amine?
The IUPAC name of 17-iodo-N,N-dimethylheptadecan-1-amine (CID 171063182) is 17-iodo-N,N-dimethylheptadecan-1-amine.
What is the SMILES notation for 17-iodo-N,N-dimethylheptadecan-1-amine?
The canonical SMILES for 17-iodo-N,N-dimethylheptadecan-1-amine is CN(C)CCCCCCCCCCCCCCCCCI.
What is the InChIKey of 17-iodo-N,N-dimethylheptadecan-1-amine?
The InChIKey is OBUJZCQBXPDMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40IN/c1-21(2)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20/h3-19H2,1-2H3.
What are the key properties of 17-iodo-N,N-dimethylheptadecan-1-amine?
17-iodo-N,N-dimethylheptadecan-1-amine has a molecular weight of 409.44 g/mol, XLogP of 6.83, 17 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 17-iodo-N,N-dimethylheptadecan-1-amine is sourced from PubChem (CID 171063182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).