About 5-iodo-N,N-dimethylpentan-1-amine
5-iodo-N,N-dimethylpentan-1-amine (PubChem CID 139910591) has the molecular formula C7H16IN
and a molecular weight of 241.12 g/mol. Its IUPAC name is 5-iodo-N,N-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-iodo-N,N-dimethylpentan-1-amine |
| PubChem CID | 139910591 |
| Molecular Formula | C7H16IN |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 5-iodo-N,N-dimethylpentan-1-amine |
| SMILES | CN(C)CCCCCI |
| InChI | InChI=1S/C7H16IN/c1-9(2)7-5-3-4-6-8/h3-7H2,1-2H3 |
| InChIKey | KZDREJMHTIXYJC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N,N-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N,N-dimethylpentan-1-amine?
The IUPAC name of 5-iodo-N,N-dimethylpentan-1-amine (CID 139910591) is 5-iodo-N,N-dimethylpentan-1-amine.
What is the SMILES notation for 5-iodo-N,N-dimethylpentan-1-amine?
The canonical SMILES for 5-iodo-N,N-dimethylpentan-1-amine is CN(C)CCCCCI.
What is the InChIKey of 5-iodo-N,N-dimethylpentan-1-amine?
The InChIKey is KZDREJMHTIXYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16IN/c1-9(2)7-5-3-4-6-8/h3-7H2,1-2H3.
What are the key properties of 5-iodo-N,N-dimethylpentan-1-amine?
5-iodo-N,N-dimethylpentan-1-amine has a molecular weight of 241.12 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N,N-dimethylpentan-1-amine is sourced from PubChem (CID 139910591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).