C9H21Cl2N — CID 19031570
3-chloro-N,N-dipropylpropan-1-amine;hydrochloride (PubChem CID 19031570) has the molecular formula C9H21Cl2N and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-chloro-N,N-dipropylpropan-1-amine;hydrochloride.
| Compound Name | 3-chloro-N,N-dipropylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 19031570 |
| Molecular Formula | C9H21Cl2N |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3-chloro-N,N-dipropylpropan-1-amine;hydrochloride |
| SMILES | CCCN(CCC)CCCCl.Cl |
| InChI | InChI=1S/C9H20ClN.ClH/c1-3-7-11(8-4-2)9-5-6-10;/h3-9H2,1-2H3;1H |
| InChIKey | JOTPBWHXUWXGQL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|