C8H18ClN3 — CID 159163841
3-chloro-N,N-dimethylpropan-1-amine;N'-ethylmethanediimine (PubChem CID 159163841) has the molecular formula C8H18ClN3 and a molecular weight of 191.71 g/mol. Its IUPAC name is 3-chloro-N,N-dimethylpropan-1-amine;N'-ethylmethanediimine.
| Compound Name | 3-chloro-N,N-dimethylpropan-1-amine;N'-ethylmethanediimine |
|---|---|
| PubChem CID | 159163841 |
| Molecular Formula | C8H18ClN3 |
| Molecular Weight | 191.71 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 3-chloro-N,N-dimethylpropan-1-amine;N'-ethylmethanediimine |
| SMILES | CCN=C=N.CN(C)CCCCl |
| InChI | InChI=1S/C5H12ClN.C3H6N2/c1-7(2)5-3-4-6;1-2-5-3-4/h3-5H2,1-2H3;4H,2H2,1H3 |
| InChIKey | KKVBZICUVLADIP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|