C8H51ClN14 — CID 174499626
azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 174499626) has the molecular formula C8H51ClN14 and a molecular weight of 379.05 g/mol. Its IUPAC name is azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 174499626 |
| Molecular Formula | C8H51ClN14 |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 378.41 |
| IUPAC Name | azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CCN=C=NCCCN(C)C.Cl.N.N.N.N.N.N.N.N.N.N.N |
| InChI | InChI=1S/C8H17N3.ClH.11H3N/c1-4-9-8-10-6-5-7-11(2)3;;;;;;;;;;;;/h4-7H2,1-3H3;1H;11*1H3 |
| InChIKey | SOZPALZIEUQGLS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 412.96 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|