C12H27N3O — CID 170171084
butan-1-ol;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine (PubChem CID 170171084) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is butan-1-ol;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine.
| Compound Name | butan-1-ol;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 170171084 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | butan-1-ol;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
| SMILES | CCCCO.CCN=C=NCCCN(C)C |
| InChI | InChI=1S/C8H17N3.C4H10O/c1-4-9-8-10-6-5-7-11(2)3;1-2-3-4-5/h4-7H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | LBQYZZQRKCUIRO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|