C8H17N3O2 — CID 152553088
[3-(ethyliminomethylideneamino)propyl-(hydroxymethyl)amino]methanol (PubChem CID 152553088) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is [3-(ethyliminomethylideneamino)propyl-(hydroxymethyl)amino]methanol.
| Compound Name | [3-(ethyliminomethylideneamino)propyl-(hydroxymethyl)amino]methanol |
|---|---|
| PubChem CID | 152553088 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | [3-(ethyliminomethylideneamino)propyl-(hydroxymethyl)amino]methanol |
| SMILES | CCN=C=NCCCN(CO)CO |
| InChI | InChI=1S/C8H17N3O2/c1-2-9-6-10-4-3-5-11(7-12)8-13/h12-13H,2-5,7-8H2,1H3 |
| InChIKey | YNXAEMXYHPRQSU-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|