C6H13N3S2 — CID 150563881
3-(ethyliminomethylideneamino)-N,N-bis(sulfanyl)propan-1-amine (PubChem CID 150563881) has the molecular formula C6H13N3S2 and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-bis(sulfanyl)propan-1-amine.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-bis(sulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 150563881 |
| Molecular Formula | C6H13N3S2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-bis(sulfanyl)propan-1-amine |
| SMILES | CCN=C=NCCCN(S)S |
| InChI | InChI=1S/C6H13N3S2/c1-2-7-6-8-4-3-5-9(10)11/h10-11H,2-5H2,1H3 |
| InChIKey | IKKPZBMABUGHHY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 27.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|