C16H36N4 — CID 86755171
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N-ethyl-N-propan-2-ylpropan-2-amine (PubChem CID 86755171) has the molecular formula C16H36N4 and a molecular weight of 284.49 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N-ethyl-N-propan-2-ylpropan-2-amine.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N-ethyl-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 86755171 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N-ethyl-N-propan-2-ylpropan-2-amine |
| SMILES | CCN(C(C)C)C(C)C.CCN=C=NCCCN(C)C |
| InChI | InChI=1S/C8H17N3.C8H19N/c1-4-9-8-10-6-5-7-11(2)3;1-6-9(7(2)3)8(4)5/h4-7H2,1-3H3;7-8H,6H2,1-5H3 |
| InChIKey | SZARVNFLNDTQSX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|