C10H22ClN3 — CID 162304570
N,N-dimethyl-3-(2-methylpropyliminomethylideneamino)propan-1-amine;hydrochloride (PubChem CID 162304570) has the molecular formula C10H22ClN3 and a molecular weight of 219.76 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylpropyliminomethylideneamino)propan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-(2-methylpropyliminomethylideneamino)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 162304570 |
| Molecular Formula | C10H22ClN3 |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N,N-dimethyl-3-(2-methylpropyliminomethylideneamino)propan-1-amine;hydrochloride |
| SMILES | CC(C)CN=C=NCCCN(C)C.Cl |
| InChI | InChI=1S/C10H21N3.ClH/c1-10(2)8-12-9-11-6-5-7-13(3)4;/h10H,5-8H2,1-4H3;1H |
| InChIKey | OAPIEPRWLJPMQQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|