C6H13ClN2S — CID 17365655
3-isothiocyanato-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 17365655) has the molecular formula C6H13ClN2S and a molecular weight of 180.70 g/mol. Its IUPAC name is 3-isothiocyanato-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | 3-isothiocyanato-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17365655 |
| Molecular Formula | C6H13ClN2S |
| Molecular Weight | 180.70 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 3-isothiocyanato-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCN=C=S.Cl |
| InChI | InChI=1S/C6H12N2S.ClH/c1-8(2)5-3-4-7-6-9;/h3-5H2,1-2H3;1H |
| InChIKey | WXLSVMUOXRJPIO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.70 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|