C7H16IN3 — CID 19063554
3-(iminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane (PubChem CID 19063554) has the molecular formula C7H16IN3 and a molecular weight of 269.13 g/mol. Its IUPAC name is 3-(iminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane.
| Compound Name | 3-(iminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane |
|---|---|
| PubChem CID | 19063554 |
| Molecular Formula | C7H16IN3 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-(iminomethylideneamino)-N,N-dimethylpropan-1-amine;iodomethane |
| SMILES | CI.CN(C)CCCN=C=N |
| InChI | InChI=1S/C6H13N3.CH3I/c1-9(2)5-3-4-8-6-7;1-2/h7H,3-5H2,1-2H3;1H3 |
| InChIKey | SKZWNLOXXNPWNM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|