About 3-isothiocyanato-N,N-dipropylpropan-1-amine
3-isothiocyanato-N,N-dipropylpropan-1-amine (PubChem CID 154188985) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is 3-isothiocyanato-N,N-dipropylpropan-1-amine.
Molecular Properties
| Compound Name | 3-isothiocyanato-N,N-dipropylpropan-1-amine |
| PubChem CID | 154188985 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-isothiocyanato-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCN=C=S |
| InChI | InChI=1S/C10H20N2S/c1-3-7-12(8-4-2)9-5-6-11-10-13/h3-9H2,1-2H3 |
| InChIKey | MTXVUPZRSQYCTK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-isothiocyanato-N,N-dipropylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isothiocyanato-N,N-dipropylpropan-1-amine?
The IUPAC name of 3-isothiocyanato-N,N-dipropylpropan-1-amine (CID 154188985) is 3-isothiocyanato-N,N-dipropylpropan-1-amine.
What is the SMILES notation for 3-isothiocyanato-N,N-dipropylpropan-1-amine?
The canonical SMILES for 3-isothiocyanato-N,N-dipropylpropan-1-amine is CCCN(CCC)CCCN=C=S.
What is the InChIKey of 3-isothiocyanato-N,N-dipropylpropan-1-amine?
The InChIKey is MTXVUPZRSQYCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c1-3-7-12(8-4-2)9-5-6-11-10-13/h3-9H2,1-2H3.
What are the key properties of 3-isothiocyanato-N,N-dipropylpropan-1-amine?
3-isothiocyanato-N,N-dipropylpropan-1-amine has a molecular weight of 200.35 g/mol, XLogP of 2.60, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isothiocyanato-N,N-dipropylpropan-1-amine is sourced from PubChem (CID 154188985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).