C9H19N3 — CID 134871643
2-(butyliminomethylideneamino)-N,N-dimethylethanamine (PubChem CID 134871643) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-(butyliminomethylideneamino)-N,N-dimethylethanamine.
| Compound Name | 2-(butyliminomethylideneamino)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 134871643 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 2-(butyliminomethylideneamino)-N,N-dimethylethanamine |
| SMILES | CCCCN=C=NCCN(C)C |
| InChI | InChI=1S/C9H19N3/c1-4-5-6-10-9-11-7-8-12(2)3/h4-8H2,1-3H3 |
| InChIKey | YFWXJKOOAWTETG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|