C10H23N3OS — CID 87433592
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;methylsulfinylmethane (PubChem CID 87433592) has the molecular formula C10H23N3OS and a molecular weight of 233.38 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;methylsulfinylmethane.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;methylsulfinylmethane |
|---|---|
| PubChem CID | 87433592 |
| Molecular Formula | C10H23N3OS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;methylsulfinylmethane |
| SMILES | CCN=C=NCCCN(C)C.CS(C)=O |
| InChI | InChI=1S/C8H17N3.C2H6OS/c1-4-9-8-10-6-5-7-11(2)3;1-4(2)3/h4-7H2,1-3H3;1-2H3 |
| InChIKey | MJDYGTSOGAHWSV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|