C13H12N2O9 — CID 175766216
(2S)-2-[(2-carboxy-3-nitrobenzoyl)amino]pentanedioic acid (PubChem CID 175766216) has the molecular formula C13H12N2O9 and a molecular weight of 340.24 g/mol. Its IUPAC name is (2S)-2-[(2-carboxy-3-nitrobenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-carboxy-3-nitrobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 175766216 |
| Molecular Formula | C13H12N2O9 |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (2S)-2-[(2-carboxy-3-nitrobenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cccc([N+](=O)[O-])c1C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H12N2O9/c16-9(17)5-4-7(12(19)20)14-11(18)6-2-1-3-8(15(23)24)10(6)13(21)22/h1-3,7H,4-5H2,(H,14,18)(H,16,17)(H,19,20)(H,21,22)/t7-/m0/s1 |
| InChIKey | WMPLHCVHEXJTOE-ZETCQYMHSA-N |
| XLogP | 0.34 |
| TPSA | 184.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|