C14H15NO7 — CID 108785494
2-[(2-methoxycarbonylbenzoyl)amino]pentanedioic acid (PubChem CID 108785494) has the molecular formula C14H15NO7 and a molecular weight of 309.27 g/mol. Its IUPAC name is 2-[(2-methoxycarbonylbenzoyl)amino]pentanedioic acid.
| Compound Name | 2-[(2-methoxycarbonylbenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 108785494 |
| Molecular Formula | C14H15NO7 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-[(2-methoxycarbonylbenzoyl)amino]pentanedioic acid |
| SMILES | COC(=O)c1ccccc1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H15NO7/c1-22-14(21)9-5-3-2-4-8(9)12(18)15-10(13(19)20)6-7-11(16)17/h2-5,10H,6-7H2,1H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | BDQJINUTRPHULM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |