C14H17ClN2O5 — CID 68522690
(2S)-2-[[2-(2-chloroethylamino)benzoyl]amino]pentanedioic acid (PubChem CID 68522690) has the molecular formula C14H17ClN2O5 and a molecular weight of 328.75 g/mol. Its IUPAC name is (2S)-2-[[2-(2-chloroethylamino)benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-(2-chloroethylamino)benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 68522690 |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (2S)-2-[[2-(2-chloroethylamino)benzoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccccc1NCCCl)C(=O)O |
| InChI | InChI=1S/C14H17ClN2O5/c15-7-8-16-10-4-2-1-3-9(10)13(20)17-11(14(21)22)5-6-12(18)19/h1-4,11,16H,5-8H2,(H,17,20)(H,18,19)(H,21,22)/t11-/m0/s1 |
| InChIKey | OIHWIUIEFGQXDN-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|